CAS No: 80278-94-0, Chemical Name: 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
the physical and chemical property of 80278-94-0, 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole is provided by ChemNet.com
ChemNet > CAS > 80278-94-0 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
80278-94-0 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
| Nome del prodotto |
1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole |
| Sinonimi |
cyclopent[b]indole, 1,2,3,3a,4,8b-hexahydro- |
| Formula molecolare |
C11H13N |
| Peso Molecolare |
159.2276 |
| InChI |
InChI=1/C11H13N/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10/h1-2,4,6,9,11-12H,3,5,7H2 |
| Numero CAS |
80278-94-0 |
| Struttura molecolare |
![80278-94-0 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole](https://images-a.chemnet.com/suppliers/chembase/cas64/80278-94-0.png)
|
| Densità |
1.07g/cm3 |
| Punto di ebollizione |
256.522°C at 760 mmHg |
| Indice di rifrazione |
1.573 |
| Punto d'infiammabilità |
112.54°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
